C16H22O3S — CID 102470792
[(2E,4Z)-1-methoxynona-2,4-dien-4-yl]sulfonylbenzene (PubChem CID 102470792) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is [(2E,4Z)-1-methoxynona-2,4-dien-4-yl]sulfonylbenzene.
| Compound Name | [(2E,4Z)-1-methoxynona-2,4-dien-4-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 102470792 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [(2E,4Z)-1-methoxynona-2,4-dien-4-yl]sulfonylbenzene |
| SMILES | CCCC/C=C(/C=C/COC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-3-4-6-10-16(13-9-14-19-2)20(17,18)15-11-7-5-8-12-15/h5,7-13H,3-4,6,14H2,1-2H3/b13-9+,16-10- |
| InChIKey | JRUURIULUCXOEC-AJVLGPTGSA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|