C23H38O4SSi — CID 11729858
[(2R,3S,7Z,9R)-5-(benzenesulfonyl)-9-ethyl-2-methyl-2,3,4,5,6,9-hexahydrooxonin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11729858) has the molecular formula C23H38O4SSi and a molecular weight of 438.71 g/mol. Its IUPAC name is [(2R,3S,7Z,9R)-5-(benzenesulfonyl)-9-ethyl-2-methyl-2,3,4,5,6,9-hexahydrooxonin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,7Z,9R)-5-(benzenesulfonyl)-9-ethyl-2-methyl-2,3,4,5,6,9-hexahydrooxonin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11729858 |
| Molecular Formula | C23H38O4SSi |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(2R,3S,7Z,9R)-5-(benzenesulfonyl)-9-ethyl-2-methyl-2,3,4,5,6,9-hexahydrooxonin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@@H]1/C=C\CC(S(=O)(=O)c2ccccc2)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C23H38O4SSi/c1-8-19-13-12-16-21(28(24,25)20-14-10-9-11-15-20)17-22(18(2)26-19)27-29(6,7)23(3,4)5/h9-15,18-19,21-22H,8,16-17H2,1-7H3/b13-12-/t18-,19-,21?,22+/m1/s1 |
| InChIKey | RYRBGUGUGYZLRT-XKALENABSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|