C28H46O5SSi — CID 102089646
[(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoxy]-tri(propan-2-yl)silane (PubChem CID 102089646) has the molecular formula C28H46O5SSi and a molecular weight of 522.82 g/mol. Its IUPAC name is [(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102089646 |
| Molecular Formula | C28H46O5SSi |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | [(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoxy]-tri(propan-2-yl)silane |
| SMILES | CO[C@@]1(CCS(=O)(=O)c2ccccc2)CC=C[C@H](/C=C/CCCO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C28H46O5SSi/c1-23(2)35(24(3)4,25(5)6)32-21-13-9-10-15-26-16-14-19-28(31-7,33-26)20-22-34(29,30)27-17-11-8-12-18-27/h8,10-12,14-18,23-26H,9,13,19-22H2,1-7H3/b15-10+/t26-,28-/m0/s1 |
| InChIKey | IKYQIJWUSZDBJG-JAJOQWSQSA-N |
| XLogP | 7.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|