C17H22O3S — CID 11779924
(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11779924) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is (2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11779924 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCO[C@@H]1C=C[C@H](O)[C@@H](C/C=C/CSc2ccccc2)O1 |
| InChI | InChI=1S/C17H22O3S/c1-2-19-17-12-11-15(18)16(20-17)10-6-7-13-21-14-8-4-3-5-9-14/h3-9,11-12,15-18H,2,10,13H2,1H3/b7-6+/t15-,16+,17-/m0/s1 |
| InChIKey | SNJJYWAOJCFIBR-AKLKCZIESA-N |
| XLogP | 3.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|