C11H20O5 — CID 70572460
acetic acid;(6-ethoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl)methanol (PubChem CID 70572460) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is acetic acid;(6-ethoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl)methanol.
| Compound Name | acetic acid;(6-ethoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl)methanol |
|---|---|
| PubChem CID | 70572460 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | acetic acid;(6-ethoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl)methanol |
| SMILES | CC(=O)O.CCOC1C=CC(C)C(CO)O1 |
| InChI | InChI=1S/C9H16O3.C2H4O2/c1-3-11-9-5-4-7(2)8(6-10)12-9;1-2(3)4/h4-5,7-10H,3,6H2,1-2H3;1H3,(H,3,4) |
| InChIKey | YVMWHDAJBGIJEV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|