C8H13BrO3 — CID 101192067
[(2R,3S,6R)-3-bromo-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 101192067) has the molecular formula C8H13BrO3 and a molecular weight of 237.09 g/mol. Its IUPAC name is [(2R,3S,6R)-3-bromo-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2R,3S,6R)-3-bromo-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 101192067 |
| Molecular Formula | C8H13BrO3 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | [(2R,3S,6R)-3-bromo-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | CCO[C@H]1C=C[C@H](Br)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H13BrO3/c1-2-11-8-4-3-6(9)7(5-10)12-8/h3-4,6-8,10H,2,5H2,1H3/t6-,7+,8+/m0/s1 |
| InChIKey | FWFSAHLNAMQHAZ-XLPZGREQSA-N |
| XLogP | 1.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|