C8H16O5 — CID 18974249
2-ethoxy-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 18974249) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-ethoxy-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | 2-ethoxy-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 18974249 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-ethoxy-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | CCOC1OC(CO)C(O)CC1O |
| InChI | InChI=1S/C8H16O5/c1-2-12-8-6(11)3-5(10)7(4-9)13-8/h5-11H,2-4H2,1H3 |
| InChIKey | OFACHKDKHNCYPY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |