C17H31BrO4Si — CID 10645072
[(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10645072) has the molecular formula C17H31BrO4Si and a molecular weight of 407.42 g/mol. Its IUPAC name is [(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10645072 |
| Molecular Formula | C17H31BrO4Si |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(Br)CO[C@H]1C=C[C@@H](OCC)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H31BrO4Si/c1-8-19-16-10-9-14(20-11-13(2)18)15(22-16)12-21-23(6,7)17(3,4)5/h9-10,14-16H,2,8,11-12H2,1,3-7H3/t14-,15+,16-/m0/s1 |
| InChIKey | NKFVVCPACZJNSN-XHSDSOJGSA-N |
| XLogP | 4.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|