C19H33BrO4Si — CID 10717637
[(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10717637) has the molecular formula C19H33BrO4Si and a molecular weight of 433.46 g/mol. Its IUPAC name is [(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10717637 |
| Molecular Formula | C19H33BrO4Si |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [(2R,3S,6S)-3-(2-bromoprop-2-enoxy)-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(Br)CO[C@H]1C=C[C@@H](OC/C=C/C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33BrO4Si/c1-8-9-12-21-18-11-10-16(22-13-15(2)20)17(24-18)14-23-25(6,7)19(3,4)5/h8-11,16-18H,2,12-14H2,1,3-7H3/b9-8+/t16-,17+,18-/m0/s1 |
| InChIKey | ZMLMMWHULAFOOA-NVIJWMOFSA-N |
| XLogP | 5.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|