C14H24O5Si — CID 11220330
[(1R,2R,5S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] formate (PubChem CID 11220330) has the molecular formula C14H24O5Si and a molecular weight of 300.43 g/mol. Its IUPAC name is [(1R,2R,5S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] formate.
| Compound Name | [(1R,2R,5S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] formate |
|---|---|
| PubChem CID | 11220330 |
| Molecular Formula | C14H24O5Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(1R,2R,5S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] formate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H]2C=C[C@@H](OC=O)[C@H]1O2 |
| InChI | InChI=1S/C14H24O5Si/c1-14(2,3)20(4,5)17-8-11-13-10(16-9-15)6-7-12(18-11)19-13/h6-7,9-13H,8H2,1-5H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | HCRRAYLMKXYUFO-FVCCEPFGSA-N |
| XLogP | 2.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|