C36H46O5SSi — CID 10865060
[(3S,4E)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)oxan-3-yl] acetate (PubChem CID 10865060) has the molecular formula C36H46O5SSi and a molecular weight of 618.91 g/mol. Its IUPAC name is [(3S,4E)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)oxan-3-yl] acetate.
| Compound Name | [(3S,4E)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10865060 |
| Molecular Formula | C36H46O5SSi |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | [(3S,4E)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-2-methoxy-2-(2-methyl-1-phenylsulfanylpropan-2-yl)oxan-3-yl] acetate |
| SMILES | COC1(C(C)(C)CSc2ccccc2)OCC/C(=C\CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H46O5SSi/c1-28(37)41-33-29(23-25-39-36(33,38-7)35(5,6)27-42-30-17-11-8-12-18-30)24-26-40-43(34(2,3)4,31-19-13-9-14-20-31)32-21-15-10-16-22-32/h8-22,24,33H,23,25-27H2,1-7H3/b29-24+/t33-,36?/m0/s1 |
| InChIKey | OEEZRDFYDQGKSO-PQIKEMPNSA-N |
| XLogP | 7.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|