C35H44O7SSi — CID 45273863
[(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 45273863) has the molecular formula C35H44O7SSi and a molecular weight of 636.88 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 45273863 |
| Molecular Formula | C35H44O7SSi |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O[C@H](CSc2ccccc2)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C35H44O7SSi/c1-24(36)38-31-30-28(22-37-33(41-30)26-18-12-8-13-19-26)40-34(42-44(5,6)35(2,3)4)32(31)39-29(25-16-10-7-11-17-25)23-43-27-20-14-9-15-21-27/h7-21,28-34H,22-23H2,1-6H3/t28-,29-,30-,31+,32-,33?,34+/m1/s1 |
| InChIKey | QUINRIMWXRDIIV-YQIXJWNQSA-N |
| XLogP | 7.70 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|