C32H44O9SSi — CID 45273852
[(2R,3S,4S,5R,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl acetate (PubChem CID 45273852) has the molecular formula C32H44O9SSi and a molecular weight of 632.85 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45273852 |
| Molecular Formula | C32H44O9SSi |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H](CSc2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H44O9SSi/c1-21(33)36-19-26-28(37-22(2)34)29(38-23(3)35)30(31(40-26)41-43(7,8)32(4,5)6)39-27(24-15-11-9-12-16-24)20-42-25-17-13-10-14-18-25/h9-18,26-31H,19-20H2,1-8H3/t26-,27-,28+,29+,30-,31+/m1/s1 |
| InChIKey | HTDJHEGRJHSMMI-AADAKZITSA-N |
| XLogP | 6.08 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|