C32H41FO9S — CID 153220716
[(5Z)-2-(6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-yl)oxy-5-[hydroperoxy(phenyl)methylidene]-4-methoxy-6-methyloxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 153220716) has the molecular formula C32H41FO9S and a molecular weight of 620.74 g/mol. Its IUPAC name is [(5Z)-2-(6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-yl)oxy-5-[hydroperoxy(phenyl)methylidene]-4-methoxy-6-methyloxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(5Z)-2-(6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-yl)oxy-5-[hydroperoxy(phenyl)methylidene]-4-methoxy-6-methyloxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 153220716 |
| Molecular Formula | C32H41FO9S |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [(5Z)-2-(6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-yl)oxy-5-[hydroperoxy(phenyl)methylidene]-4-methoxy-6-methyloxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | COC1/C(=C(\OO)c2ccccc2)C(C)OC(OC2C(C)OC(F)C(Sc3ccccc3)C2OC)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H41FO9S/c1-18-22(24(42-35)20-14-10-8-11-15-20)25(36-6)27(41-31(34)32(3,4)5)30(39-18)40-23-19(2)38-29(33)28(26(23)37-7)43-21-16-12-9-13-17-21/h8-19,23,25-30,35H,1-7H3/b24-22- |
| InChIKey | WNPFZZODPSHRLK-GYHWCHFESA-N |
| XLogP | 5.88 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|