C35H42O4SSi — CID 10940919
(2R,5S)-2-[(3E,5Z)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylhepta-3,5-dienyl]-5-(phenylsulfanylmethyl)-1,3-dioxolan-4-one (PubChem CID 10940919) has the molecular formula C35H42O4SSi and a molecular weight of 586.87 g/mol. Its IUPAC name is (2R,5S)-2-[(3E,5Z)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylhepta-3,5-dienyl]-5-(phenylsulfanylmethyl)-1,3-dioxolan-4-one.
| Compound Name | (2R,5S)-2-[(3E,5Z)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylhepta-3,5-dienyl]-5-(phenylsulfanylmethyl)-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 10940919 |
| Molecular Formula | C35H42O4SSi |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | (2R,5S)-2-[(3E,5Z)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylhepta-3,5-dienyl]-5-(phenylsulfanylmethyl)-1,3-dioxolan-4-one |
| SMILES | C/C=C(/C=C(\C)CC[C@H]1OC(=O)[C@@H](CSc2ccccc2)O1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H42O4SSi/c1-6-28(24-27(2)22-23-33-38-32(34(36)39-33)26-40-29-16-10-7-11-17-29)25-37-41(35(3,4)5,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h6-21,24,32-33H,22-23,25-26H2,1-5H3/b27-24+,28-6-/t32-,33-/m1/s1 |
| InChIKey | CIEBHHZHIMZOJU-OQAOWFGISA-N |
| XLogP | 7.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|