C34H44O3SSi — CID 11157258
tert-butyl-[1-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-5-methylhex-4-en-3-yl]oxy-diphenylsilane (PubChem CID 11157258) has the molecular formula C34H44O3SSi and a molecular weight of 560.88 g/mol. Its IUPAC name is tert-butyl-[1-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-5-methylhex-4-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[1-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-5-methylhex-4-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11157258 |
| Molecular Formula | C34H44O3SSi |
| Molecular Weight | 560.88 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | tert-butyl-[1-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-5-methylhex-4-en-3-yl]oxy-diphenylsilane |
| SMILES | CC(C)=CC(CC[C@H]1OC(C)(C)O[C@@H]1Sc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H44O3SSi/c1-26(2)25-27(23-24-31-32(36-34(6,7)35-31)38-28-17-11-8-12-18-28)37-39(33(3,4)5,29-19-13-9-14-20-29)30-21-15-10-16-22-30/h8-22,25,27,31-32H,23-24H2,1-7H3/t27?,31-,32-/m1/s1 |
| InChIKey | HESDMCCICHSYCP-GICUAZGISA-N |
| XLogP | 7.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.88 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|