C34H43IO3SSi — CID 10952552
tert-butyl-[(Z)-3-[(4R,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]-3-iodoprop-2-enoxy]-diphenylsilane (PubChem CID 10952552) has the molecular formula C34H43IO3SSi and a molecular weight of 686.77 g/mol. Its IUPAC name is tert-butyl-[(Z)-3-[(4R,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]-3-iodoprop-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z)-3-[(4R,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]-3-iodoprop-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10952552 |
| Molecular Formula | C34H43IO3SSi |
| Molecular Weight | 686.77 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | tert-butyl-[(Z)-3-[(4R,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]-3-iodoprop-2-enoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@@H](C(C)(C)CSc2ccccc2)[C@H](/C(I)=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C34H43IO3SSi/c1-32(2,3)40(27-19-13-9-14-20-27,28-21-15-10-16-22-28)36-24-23-29(35)30-31(38-34(6,7)37-30)33(4,5)25-39-26-17-11-8-12-18-26/h8-23,30-31H,24-25H2,1-7H3/b29-23-/t30-,31+/m0/s1 |
| InChIKey | WLZMMYLZYMAMQA-GPSSFVHFSA-N |
| XLogP | 8.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.77 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|