C20H29BrO3SSi — CID 10072811
bromomethyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane (PubChem CID 10072811) has the molecular formula C20H29BrO3SSi and a molecular weight of 457.51 g/mol. Its IUPAC name is bromomethyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane.
| Compound Name | bromomethyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10072811 |
| Molecular Formula | C20H29BrO3SSi |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | bromomethyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane |
| SMILES | CCO[C@@H]1C=C[C@H](O[Si](C)(C)CBr)[C@@H](C/C=C/CSc2ccccc2)O1 |
| InChI | InChI=1S/C20H29BrO3SSi/c1-4-22-20-14-13-19(24-26(2,3)16-21)18(23-20)12-8-9-15-25-17-10-6-5-7-11-17/h5-11,13-14,18-20H,4,12,15-16H2,1-3H3/b9-8+/t18-,19+,20+/m1/s1 |
| InChIKey | OTZCWCSGGNKRDL-KETBWLHESA-N |
| XLogP | 5.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|