C18H30O2SSi — CID 135022716
tert-butyl-dimethyl-[(3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl]oxysilane (PubChem CID 135022716) has the molecular formula C18H30O2SSi and a molecular weight of 338.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 135022716 |
| Molecular Formula | C18H30O2SSi |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl]oxysilane |
| SMILES | CC1O[C@@H](Sc2ccccc2)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O2SSi/c1-14-16(20-22(5,6)18(2,3)4)12-13-17(19-14)21-15-10-8-7-9-11-15/h7-11,14,16-17H,12-13H2,1-6H3/t14?,16-,17-/m0/s1 |
| InChIKey | AJEXRDNFLXDQEL-HGVHAKBWSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|