C43H50O2S2Si — CID 54274074
tert-butyl-[[(2S)-5-(1-methyl-4-propan-2-ylcyclohexa-2,4-dien-1-yl)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy]-diphenylsilane (PubChem CID 54274074) has the molecular formula C43H50O2S2Si and a molecular weight of 691.09 g/mol. Its IUPAC name is tert-butyl-[[(2S)-5-(1-methyl-4-propan-2-ylcyclohexa-2,4-dien-1-yl)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-5-(1-methyl-4-propan-2-ylcyclohexa-2,4-dien-1-yl)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 54274074 |
| Molecular Formula | C43H50O2S2Si |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | tert-butyl-[[(2S)-5-(1-methyl-4-propan-2-ylcyclohexa-2,4-dien-1-yl)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)C1=CCC(C)(C2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC2(Sc2ccccc2)Sc2ccccc2)C=C1 |
| InChI | InChI=1S/C43H50O2S2Si/c1-33(2)34-27-29-42(6,30-28-34)40-43(46-36-19-11-7-12-20-36,47-37-21-13-8-14-22-37)31-35(45-40)32-44-48(41(3,4)5,38-23-15-9-16-24-38)39-25-17-10-18-26-39/h7-29,33,35,40H,30-32H2,1-6H3/t35-,40?,42?/m0/s1 |
| InChIKey | RMEHWJXAIONSKV-VTYQARCLSA-N |
| XLogP | 10.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|