C28H34OSSi — CID 140536386
tert-butyl-[[(2S,5S)-5-methyl-4-phenylsulfanyloxolan-2-yl]methyl]-diphenylsilane (PubChem CID 140536386) has the molecular formula C28H34OSSi and a molecular weight of 446.73 g/mol. Its IUPAC name is tert-butyl-[[(2S,5S)-5-methyl-4-phenylsulfanyloxolan-2-yl]methyl]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,5S)-5-methyl-4-phenylsulfanyloxolan-2-yl]methyl]-diphenylsilane |
|---|---|
| PubChem CID | 140536386 |
| Molecular Formula | C28H34OSSi |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | tert-butyl-[[(2S,5S)-5-methyl-4-phenylsulfanyloxolan-2-yl]methyl]-diphenylsilane |
| SMILES | C[C@@H]1O[C@H](C[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1Sc1ccccc1 |
| InChI | InChI=1S/C28H34OSSi/c1-22-27(30-24-14-8-5-9-15-24)20-23(29-22)21-31(28(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,22-23,27H,20-21H2,1-4H3/t22-,23-,27?/m0/s1 |
| InChIKey | BORDDUMRVJRIMW-ZDNIZFJCSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|