C26H31FOSSi — CID 10622899
tert-butyl-[4-(4-fluorophenyl)sulfanylbutoxy]-diphenylsilane (PubChem CID 10622899) has the molecular formula C26H31FOSSi and a molecular weight of 438.68 g/mol. Its IUPAC name is tert-butyl-[4-(4-fluorophenyl)sulfanylbutoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(4-fluorophenyl)sulfanylbutoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10622899 |
| Molecular Formula | C26H31FOSSi |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | tert-butyl-[4-(4-fluorophenyl)sulfanylbutoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCSc1ccc(F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31FOSSi/c1-26(2,3)30(24-12-6-4-7-13-24,25-14-8-5-9-15-25)28-20-10-11-21-29-23-18-16-22(27)17-19-23/h4-9,12-19H,10-11,20-21H2,1-3H3 |
| InChIKey | KCUJJTMNSIJGKX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|