C21H21F2SSi+ — CID 177286374
(3,5-difluorophenyl)-phenyl-(4-trimethylsilylphenyl)sulfanium (PubChem CID 177286374) has the molecular formula C21H21F2SSi+ and a molecular weight of 371.55 g/mol. Its IUPAC name is (3,5-difluorophenyl)-phenyl-(4-trimethylsilylphenyl)sulfanium.
| Compound Name | (3,5-difluorophenyl)-phenyl-(4-trimethylsilylphenyl)sulfanium |
|---|---|
| PubChem CID | 177286374 |
| Molecular Formula | C21H21F2SSi+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3,5-difluorophenyl)-phenyl-(4-trimethylsilylphenyl)sulfanium |
| SMILES | C[Si](C)(C)c1ccc([S+](c2ccccc2)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C21H21F2SSi/c1-25(2,3)21-11-9-19(10-12-21)24(18-7-5-4-6-8-18)20-14-16(22)13-17(23)15-20/h4-15H,1-3H3/q+1 |
| InChIKey | UZDHBKHWTLUSLY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|