C29H36O4SSi — CID 11103203
methyl (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoate (PubChem CID 11103203) has the molecular formula C29H36O4SSi and a molecular weight of 508.76 g/mol. Its IUPAC name is methyl (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoate.
| Compound Name | methyl (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 11103203 |
| Molecular Formula | C29H36O4SSi |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | methyl (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoate |
| SMILES | COC(=O)C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36O4SSi/c1-23(22-34(31)24-15-9-6-10-16-24)27(21-28(30)32-5)33-35(29(2,3)4,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27H,21-22H2,1-5H3/t23-,27+,34?/m1/s1 |
| InChIKey | KZBDDFGAEXAZER-BCDCPGLGSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|