C28H32O6SSi — CID 23583996
[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 23583996) has the molecular formula C28H32O6SSi and a molecular weight of 524.71 g/mol. Its IUPAC name is [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23583996 |
| Molecular Formula | C28H32O6SSi |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)C[C@@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H32O6SSi/c1-21-15-17-22(18-16-21)35(30,31)32-20-26-25(19-27(29)33-26)34-36(28(2,3)4,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,25-26H,19-20H2,1-4H3/t25-,26+/m0/s1 |
| InChIKey | HLZVWYUPRCJWPG-IZZNHLLZSA-N |
| XLogP | 3.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|