C26H34O3S2Si — CID 10863861
(5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)-1-oxaspiro[4.4]nonan-2-one (PubChem CID 10863861) has the molecular formula C26H34O3S2Si and a molecular weight of 486.78 g/mol. Its IUPAC name is (5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 10863861 |
| Molecular Formula | C26H34O3S2Si |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,3-bis(phenylsulfanyl)-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]12CC(Sc1ccccc1)(Sc1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C26H34O3S2Si/c1-24(2,3)32(4,5)29-22-17-12-18-25(22)19-26(23(27)28-25,30-20-13-8-6-9-14-20)31-21-15-10-7-11-16-21/h6-11,13-16,22H,12,17-19H2,1-5H3/t22-,25-/m0/s1 |
| InChIKey | AFJLHHFCNCQMTD-DHLKQENFSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|