C40H70O6SSi2 — CID 11343132
(5S)-3-[(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 11343132) has the molecular formula C40H70O6SSi2 and a molecular weight of 735.23 g/mol. Its IUPAC name is (5S)-3-[(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11343132 |
| Molecular Formula | C40H70O6SSi2 |
| Molecular Weight | 735.23 g/mol |
| Exact Mass | 734.44 |
| IUPAC Name | (5S)-3-[(2R,13R)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(2R)-5-oxooxolan-2-yl]tridecyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1CC(C[C@@H](CCCCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CCC(=O)O2)O[Si](C)(C)C(C)(C)C)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C40H70O6SSi2/c1-31-29-40(37(42)43-31,47-33-24-20-18-21-25-33)30-32(45-48(8,9)38(2,3)4)23-19-16-14-12-13-15-17-22-26-35(34-27-28-36(41)44-34)46-49(10,11)39(5,6)7/h18,20-21,24-25,31-32,34-35H,12-17,19,22-23,26-30H2,1-11H3/t31-,32+,34+,35+,40?/m0/s1 |
| InChIKey | AKSLIHHURNBRBB-DSCIEHJGSA-N |
| XLogP | 11.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.23 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|