C26H42O3SSi — CID 11317192
(5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxynon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 11317192) has the molecular formula C26H42O3SSi and a molecular weight of 462.77 g/mol. Its IUPAC name is (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxynon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxynon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11317192 |
| Molecular Formula | C26H42O3SSi |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (5S)-3-[(2R)-2-[tert-butyl(dimethyl)silyl]oxynon-8-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C=CCCCCC[C@H](CC1(Sc2ccccc2)C[C@H](C)OC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O3SSi/c1-8-9-10-11-13-16-22(29-31(6,7)25(3,4)5)20-26(19-21(2)28-24(26)27)30-23-17-14-12-15-18-23/h8,12,14-15,17-18,21-22H,1,9-11,13,16,19-20H2,2-7H3/t21-,22+,26?/m0/s1 |
| InChIKey | OEBAOTPMNPCAJV-SMWUWQHRSA-N |
| XLogP | 7.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|