C21H29IO2S — CID 10412521
(5S)-3-[(E)-10-iododec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10412521) has the molecular formula C21H29IO2S and a molecular weight of 472.43 g/mol. Its IUPAC name is (5S)-3-[(E)-10-iododec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(E)-10-iododec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10412521 |
| Molecular Formula | C21H29IO2S |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (5S)-3-[(E)-10-iododec-9-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1CC(CCCCCCCC/C=C/I)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C21H29IO2S/c1-18-17-21(20(23)24-18,25-19-13-9-8-10-14-19)15-11-6-4-2-3-5-7-12-16-22/h8-10,12-14,16,18H,2-7,11,15,17H2,1H3/b16-12+/t18-,21?/m0/s1 |
| InChIKey | RTKADORVYBGKLX-HDODFFLZSA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|