C19H25IO2S — CID 10433562
(5S)-3-[(E)-8-iodooct-7-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10433562) has the molecular formula C19H25IO2S and a molecular weight of 444.38 g/mol. Its IUPAC name is (5S)-3-[(E)-8-iodooct-7-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(E)-8-iodooct-7-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10433562 |
| Molecular Formula | C19H25IO2S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (5S)-3-[(E)-8-iodooct-7-enyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1CC(CCCCCC/C=C/I)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H25IO2S/c1-16-15-19(18(21)22-16,23-17-11-7-6-8-12-17)13-9-4-2-3-5-10-14-20/h6-8,10-12,14,16H,2-5,9,13,15H2,1H3/b14-10+/t16-,19?/m0/s1 |
| InChIKey | JHCFCPFSFOIQQR-LHOFBGDYSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|