C29H48O3SSi2 — CID 10995052
(3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-trimethylsilylnon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10995052) has the molecular formula C29H48O3SSi2 and a molecular weight of 532.94 g/mol. Its IUPAC name is (3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-trimethylsilylnon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-trimethylsilylnon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10995052 |
| Molecular Formula | C29H48O3SSi2 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | (3R,5R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-9-trimethylsilylnon-8-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@@H]1C[C@](C[C@H](CCCCCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C29H48O3SSi2/c1-24-22-29(27(30)31-24,33-26-19-15-13-16-20-26)23-25(32-35(8,9)28(2,3)4)18-14-11-10-12-17-21-34(5,6)7/h13,15-16,19-20,24-25H,10-12,14,18,22-23H2,1-9H3/t24-,25+,29-/m1/s1 |
| InChIKey | SVDOJEOMJJECLL-BEYSDYMESA-N |
| XLogP | 8.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|