C24H34O2SSi — CID 134940383
(2R,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanal (PubChem CID 134940383) has the molecular formula C24H34O2SSi and a molecular weight of 414.69 g/mol. Its IUPAC name is (2R,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanal.
| Compound Name | (2R,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanal |
|---|---|
| PubChem CID | 134940383 |
| Molecular Formula | C24H34O2SSi |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2R,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanal |
| SMILES | CC[Si](CC)(CC)O[C@H](CCc1ccccc1)[C@H](C=O)CSc1ccccc1 |
| InChI | InChI=1S/C24H34O2SSi/c1-4-28(5-2,6-3)26-24(18-17-21-13-9-7-10-14-21)22(19-25)20-27-23-15-11-8-12-16-23/h7-16,19,22,24H,4-6,17-18,20H2,1-3H3/t22-,24-/m1/s1 |
| InChIKey | CNGOQAPLQJPEAW-ISKFKSNPSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|