C20H30O2S — CID 134874957
6-cyclohexyl-5-methoxy-4-methyl-6-phenylsulfanylhexan-3-one (PubChem CID 134874957) has the molecular formula C20H30O2S and a molecular weight of 334.52 g/mol. Its IUPAC name is 6-cyclohexyl-5-methoxy-4-methyl-6-phenylsulfanylhexan-3-one.
| Compound Name | 6-cyclohexyl-5-methoxy-4-methyl-6-phenylsulfanylhexan-3-one |
|---|---|
| PubChem CID | 134874957 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 6-cyclohexyl-5-methoxy-4-methyl-6-phenylsulfanylhexan-3-one |
| SMILES | CCC(=O)C(C)C(OC)C(Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30O2S/c1-4-18(21)15(2)19(22-3)20(16-11-7-5-8-12-16)23-17-13-9-6-10-14-17/h6,9-10,13-16,19-20H,4-5,7-8,11-12H2,1-3H3 |
| InChIKey | MKFVUSXJOXKMJJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |