C27H34O3SSi — CID 11113393
[(3S)-4-(benzenesulfonyl)-3-methylbutoxy]-tert-butyl-diphenylsilane (PubChem CID 11113393) has the molecular formula C27H34O3SSi and a molecular weight of 466.72 g/mol. Its IUPAC name is [(3S)-4-(benzenesulfonyl)-3-methylbutoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(3S)-4-(benzenesulfonyl)-3-methylbutoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11113393 |
| Molecular Formula | C27H34O3SSi |
| Molecular Weight | 466.72 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(3S)-4-(benzenesulfonyl)-3-methylbutoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H34O3SSi/c1-23(22-31(28,29)24-14-8-5-9-15-24)20-21-30-32(27(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,23H,20-22H2,1-4H3/t23-/m0/s1 |
| InChIKey | NJNPVNRQHIKRAO-QHCPKHFHSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|