C22H34O4SSi — CID 134956394
cis-(1S,2R)-1-(benzenesulfonyl)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]cyclobutane-1-carbaldehyde (PubChem CID 134956394) has the molecular formula C22H34O4SSi and a molecular weight of 422.66 g/mol. Its IUPAC name is cis-(1S,2R)-1-(benzenesulfonyl)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]cyclobutane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-1-(benzenesulfonyl)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 134956394 |
| Molecular Formula | C22H34O4SSi |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | cis-(1S,2R)-1-(benzenesulfonyl)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]cyclobutane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/[C@H]1CC[C@]1(C=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34O4SSi/c1-21(2,3)28(4,5)26-17-11-7-8-12-19-15-16-22(19,18-23)27(24,25)20-13-9-6-10-14-20/h6,8-10,12-14,18-19H,7,11,15-17H2,1-5H3/b12-8+/t19-,22+/m0/s1 |
| InChIKey | QUVBBGZMEJVWMU-HOHQBBCWSA-N |
| XLogP | 5.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|