C18H32O3SSi — CID 99772183
[(2S)-2-(benzenesulfonylmethyl)-3-methylbutoxy]-tert-butyl-dimethylsilane (PubChem CID 99772183) has the molecular formula C18H32O3SSi and a molecular weight of 356.60 g/mol. Its IUPAC name is [(2S)-2-(benzenesulfonylmethyl)-3-methylbutoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S)-2-(benzenesulfonylmethyl)-3-methylbutoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 99772183 |
| Molecular Formula | C18H32O3SSi |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(2S)-2-(benzenesulfonylmethyl)-3-methylbutoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)[C@@H](CO[Si](C)(C)C(C)(C)C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H32O3SSi/c1-15(2)16(13-21-23(6,7)18(3,4)5)14-22(19,20)17-11-9-8-10-12-17/h8-12,15-16H,13-14H2,1-7H3/t16-/m0/s1 |
| InChIKey | QERUHXIRYRNEAJ-INIZCTEOSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|