C21H32O4SSi — CID 102294081
3-[(1S,2S,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]propanal (PubChem CID 102294081) has the molecular formula C21H32O4SSi and a molecular weight of 408.64 g/mol. Its IUPAC name is 3-[(1S,2S,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]propanal.
| Compound Name | 3-[(1S,2S,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]propanal |
|---|---|
| PubChem CID | 102294081 |
| Molecular Formula | C21H32O4SSi |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[(1S,2S,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]propanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=C[C@H](S(=O)(=O)c2ccccc2)[C@H]1CCC=O |
| InChI | InChI=1S/C21H32O4SSi/c1-21(2,3)27(4,5)25-19-14-9-15-20(18(19)13-10-16-22)26(23,24)17-11-7-6-8-12-17/h6-9,11-12,15-16,18-20H,10,13-14H2,1-5H3/t18-,19-,20-/m0/s1 |
| InChIKey | YCGMIQFHPNUDGZ-UFYCRDLUSA-N |
| XLogP | 4.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|