C23H36O3SSi — CID 44517966
(3S)-6-(benzenesulfonyl)-3-[2-tri(propan-2-yl)silylethynyl]hexanal (PubChem CID 44517966) has the molecular formula C23H36O3SSi and a molecular weight of 420.69 g/mol. Its IUPAC name is (3S)-6-(benzenesulfonyl)-3-[2-tri(propan-2-yl)silylethynyl]hexanal.
| Compound Name | (3S)-6-(benzenesulfonyl)-3-[2-tri(propan-2-yl)silylethynyl]hexanal |
|---|---|
| PubChem CID | 44517966 |
| Molecular Formula | C23H36O3SSi |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (3S)-6-(benzenesulfonyl)-3-[2-tri(propan-2-yl)silylethynyl]hexanal |
| SMILES | CC(C)[Si](C#C[C@H](CC=O)CCCS(=O)(=O)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36O3SSi/c1-19(2)28(20(3)4,21(5)6)18-15-22(14-16-24)11-10-17-27(25,26)23-12-8-7-9-13-23/h7-9,12-13,16,19-22H,10-11,14,17H2,1-6H3/t22-/m0/s1 |
| InChIKey | ZYXCMMGHGRTPKO-QFIPXVFZSA-N |
| XLogP | 5.67 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|