C18H28O3S — CID 10496232
2-[2-(benzenesulfonyl)ethyl]decanal (PubChem CID 10496232) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethyl]decanal.
| Compound Name | 2-[2-(benzenesulfonyl)ethyl]decanal |
|---|---|
| PubChem CID | 10496232 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethyl]decanal |
| SMILES | CCCCCCCCC(C=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O3S/c1-2-3-4-5-6-8-11-17(16-19)14-15-22(20,21)18-12-9-7-10-13-18/h7,9-10,12-13,16-17H,2-6,8,11,14-15H2,1H3 |
| InChIKey | IXDIPOCWJHZQRP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|