C19H28O4SSi — CID 46187576
cis-(1S,2R)-1-(benzenesulfonyl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclobutane-1-carbaldehyde (PubChem CID 46187576) has the molecular formula C19H28O4SSi and a molecular weight of 380.58 g/mol. Its IUPAC name is cis-(1S,2R)-1-(benzenesulfonyl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclobutane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-1-(benzenesulfonyl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 46187576 |
| Molecular Formula | C19H28O4SSi |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | cis-(1S,2R)-1-(benzenesulfonyl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclobutane-1-carbaldehyde |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@]1(C=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H28O4SSi/c1-15(23-25(5,6)18(2,3)4)17-12-13-19(17,14-20)24(21,22)16-10-8-7-9-11-16/h7-11,14,17H,1,12-13H2,2-6H3/t17-,19-/m1/s1 |
| InChIKey | VVZNEOWMJOQFGV-IEBWSBKVSA-N |
| XLogP | 4.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|