C23H42O5SSi2 — CID 10814805
(4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one (PubChem CID 10814805) has the molecular formula C23H42O5SSi2 and a molecular weight of 486.82 g/mol. Its IUPAC name is (4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one.
| Compound Name | (4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one |
|---|---|
| PubChem CID | 10814805 |
| Molecular Formula | C23H42O5SSi2 |
| Molecular Weight | 486.82 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CC(=O)CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O5SSi2/c1-22(2,3)30(7,8)27-17-20(28-31(9,10)23(4,5)6)16-19(24)18-29(25,26)21-14-12-11-13-15-21/h11-15,20H,16-18H2,1-10H3/t20-/m0/s1 |
| InChIKey | BLZPRRLBSSSUFC-FQEVSTJZSA-N |
| XLogP | 5.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|