C28H50O4SSi2 — CID 155931673
[(2S,4Z,6E,8S)-10-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxydeca-4,6-dien-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 155931673) has the molecular formula C28H50O4SSi2 and a molecular weight of 538.94 g/mol. Its IUPAC name is [(2S,4Z,6E,8S)-10-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxydeca-4,6-dien-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4Z,6E,8S)-10-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxydeca-4,6-dien-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 155931673 |
| Molecular Formula | C28H50O4SSi2 |
| Molecular Weight | 538.94 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | [(2S,4Z,6E,8S)-10-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxydeca-4,6-dien-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](C/C=C\C=C\[C@H](CCS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O4SSi2/c1-24(31-34(8,9)27(2,3)4)18-14-12-15-19-25(32-35(10,11)28(5,6)7)22-23-33(29,30)26-20-16-13-17-21-26/h12-17,19-21,24-25H,18,22-23H2,1-11H3/b14-12-,19-15+/t24-,25+/m0/s1 |
| InChIKey | LODRRQWXIPQIDL-LBZZNWLBSA-N |
| XLogP | 8.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.94 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|