C27H44O4SSi — CID 10815029
(4S,7E,9S)-11-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9-tetramethylundeca-1,7-dien-6-one (PubChem CID 10815029) has the molecular formula C27H44O4SSi and a molecular weight of 492.80 g/mol. Its IUPAC name is (4S,7E,9S)-11-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9-tetramethylundeca-1,7-dien-6-one.
| Compound Name | (4S,7E,9S)-11-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9-tetramethylundeca-1,7-dien-6-one |
|---|---|
| PubChem CID | 10815029 |
| Molecular Formula | C27H44O4SSi |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (4S,7E,9S)-11-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9-tetramethylundeca-1,7-dien-6-one |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)/C(C)=C/[C@@H](C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H44O4SSi/c1-11-15-24(31-33(9,10)26(4,5)6)27(7,8)25(28)22(3)20-21(2)18-19-32(29,30)23-16-13-12-14-17-23/h11-14,16-17,20-21,24H,1,15,18-19H2,2-10H3/b22-20+/t21-,24-/m0/s1 |
| InChIKey | OEGLHJITAYILHT-ZRNLMPLWSA-N |
| XLogP | 6.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|