C27H40O4SSi — CID 11102994
4-[(Z)-6-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-1-enyl]-4-methylcyclohexa-2,5-dien-1-one (PubChem CID 11102994) has the molecular formula C27H40O4SSi and a molecular weight of 488.77 g/mol. Its IUPAC name is 4-[(Z)-6-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-1-enyl]-4-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[(Z)-6-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-1-enyl]-4-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 11102994 |
| Molecular Formula | C27H40O4SSi |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 4-[(Z)-6-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-1-enyl]-4-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1(/C=C\C(O[Si](C)(C)C(C)(C)C)C(C)(C)CCS(=O)(=O)c2ccccc2)C=CC(=O)C=C1 |
| InChI | InChI=1S/C27H40O4SSi/c1-25(2,3)33(7,8)31-24(16-19-27(6)17-14-22(28)15-18-27)26(4,5)20-21-32(29,30)23-12-10-9-11-13-23/h9-19,24H,20-21H2,1-8H3/b19-16- |
| InChIKey | NXFKAKVPFVCCID-MNDPQUGUSA-N |
| XLogP | 6.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|