C18H26O3SSi — CID 10665588
[(1R,6R)-6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10665588) has the molecular formula C18H26O3SSi and a molecular weight of 350.56 g/mol. Its IUPAC name is [(1R,6R)-6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,6R)-6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10665588 |
| Molecular Formula | C18H26O3SSi |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [(1R,6R)-6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CC=C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O3SSi/c1-18(2,3)23(4,5)21-16-13-9-10-14-17(16)22(19,20)15-11-7-6-8-12-15/h6-14,16-17H,1-5H3/t16-,17-/m1/s1 |
| InChIKey | ZBWKNPCQVUONGM-IAGOWNOFSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|