C28H40O4SSi — CID 10323727
(4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one (PubChem CID 10323727) has the molecular formula C28H40O4SSi and a molecular weight of 500.78 g/mol. Its IUPAC name is (4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one.
| Compound Name | (4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one |
|---|---|
| PubChem CID | 10323727 |
| Molecular Formula | C28H40O4SSi |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | (4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4-methylidene-4a,5,6,8-tetrahydrobenzo[8]annulen-3-one |
| SMILES | C=C1C(=O)C=C[C@@]2(C)/C=C\[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C28H40O4SSi/c1-20-22(29)15-17-28(7)18-16-24(32-34(8,9)26(2,3)4)27(5,6)19-23(25(20)28)33(30,31)21-13-11-10-12-14-21/h10-18,23-25H,1,19H2,2-9H3/b18-16-/t23-,24+,25-,28+/m1/s1 |
| InChIKey | WRIQIVNPRHTRCX-KCDSCOOWSA-N |
| XLogP | 6.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|