C30H44O6SSi — CID 10530917
ethyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate (PubChem CID 10530917) has the molecular formula C30H44O6SSi and a molecular weight of 560.83 g/mol. Its IUPAC name is ethyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate.
| Compound Name | ethyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate |
|---|---|
| PubChem CID | 10530917 |
| Molecular Formula | C30H44O6SSi |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | ethyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=C[C@@]2(C)/C=C\[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C30H44O6SSi/c1-10-35-27(32)25-22(31)16-18-30(7)19-17-24(36-38(8,9)28(2,3)4)29(5,6)20-23(26(25)30)37(33,34)21-14-12-11-13-15-21/h11-19,23-26H,10,20H2,1-9H3/b19-17-/t23-,24+,25-,26+,30+/m1/s1 |
| InChIKey | RXDUMAJDGWQQTR-QYBFRMCASA-N |
| XLogP | 6.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|