C22H26O5S — CID 10787304
ethyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate (PubChem CID 10787304) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is ethyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate.
| Compound Name | ethyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate |
|---|---|
| PubChem CID | 10787304 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | ethyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=C[C@@]2(C)/C=C\CCC[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C22H26O5S/c1-3-27-21(24)19-17(23)13-15-22(2)14-9-5-8-12-18(20(19)22)28(25,26)16-10-6-4-7-11-16/h4,6-7,9-11,13-15,18-20H,3,5,8,12H2,1-2H3/b14-9-/t18-,19-,20+,22-/m1/s1 |
| InChIKey | ZHFWPPPOBYXSPG-MNLKLDOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|