C23H24O5S — CID 101455151
ethyl (1S,6R)-3-[(4-methylphenyl)sulfonylmethyl]-2-oxo-6-phenylcyclohex-3-ene-1-carboxylate (PubChem CID 101455151) has the molecular formula C23H24O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is ethyl (1S,6R)-3-[(4-methylphenyl)sulfonylmethyl]-2-oxo-6-phenylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6R)-3-[(4-methylphenyl)sulfonylmethyl]-2-oxo-6-phenylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 101455151 |
| Molecular Formula | C23H24O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | ethyl (1S,6R)-3-[(4-methylphenyl)sulfonylmethyl]-2-oxo-6-phenylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C(CS(=O)(=O)c2ccc(C)cc2)=CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H24O5S/c1-3-28-23(25)21-20(17-7-5-4-6-8-17)14-11-18(22(21)24)15-29(26,27)19-12-9-16(2)10-13-19/h4-13,20-21H,3,14-15H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | XFVUNIIHPYGCND-SFTDATJTSA-N |
| XLogP | 3.63 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|