C18H16O4S — CID 14176857
ethyl 1-benzyl-1,3-dioxo-1-benzothiophene-2-carboxylate (PubChem CID 14176857) has the molecular formula C18H16O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is ethyl 1-benzyl-1,3-dioxo-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 1-benzyl-1,3-dioxo-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 14176857 |
| Molecular Formula | C18H16O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | ethyl 1-benzyl-1,3-dioxo-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)C1=S(=O)(Cc2ccccc2)c2ccccc2C1=O |
| InChI | InChI=1S/C18H16O4S/c1-2-22-18(20)17-16(19)14-10-6-7-11-15(14)23(17,21)12-13-8-4-3-5-9-13/h3-11H,2,12H2,1H3 |
| InChIKey | ZSVKFJNYEHHERX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|